C17H22N6O — CID 118771504
2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 118771504) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | 2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 118771504 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(Cn1cncn1)C(=O)NCCCc1nc2ccccc2n1C |
| InChI | InChI=1S/C17H22N6O/c1-13(10-23-12-18-11-20-23)17(24)19-9-5-8-16-21-14-6-3-4-7-15(14)22(16)2/h3-4,6-7,11-13H,5,8-10H2,1-2H3,(H,19,24) |
| InChIKey | WCPGDJKHVXIAOH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|