C21H28Cl2N4O — CID 119889914
3-amino-2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-phenylpropanamide;dihydrochloride (PubChem CID 119889914) has the molecular formula C21H28Cl2N4O and a molecular weight of 423.39 g/mol. Its IUPAC name is 3-amino-2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-phenylpropanamide;dihydrochloride.
| Compound Name | 3-amino-2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-phenylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119889914 |
| Molecular Formula | C21H28Cl2N4O |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-amino-2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]-3-phenylpropanamide;dihydrochloride |
| SMILES | CC(C(=O)NCCCc1nc2ccccc2n1C)C(N)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C21H26N4O.2ClH/c1-15(20(22)16-9-4-3-5-10-16)21(26)23-14-8-13-19-24-17-11-6-7-12-18(17)25(19)2;;/h3-7,9-12,15,20H,8,13-14,22H2,1-2H3,(H,23,26);2*1H |
| InChIKey | FNKLHPOLZNBQRZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|