C16H26N4O4S — CID 118771640
1-[(3-hydroxypiperidin-3-yl)methyl]-3-[4-(propylsulfamoyl)phenyl]urea (PubChem CID 118771640) has the molecular formula C16H26N4O4S and a molecular weight of 370.48 g/mol. Its IUPAC name is 1-[(3-hydroxypiperidin-3-yl)methyl]-3-[4-(propylsulfamoyl)phenyl]urea.
| Compound Name | 1-[(3-hydroxypiperidin-3-yl)methyl]-3-[4-(propylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 118771640 |
| Molecular Formula | C16H26N4O4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[(3-hydroxypiperidin-3-yl)methyl]-3-[4-(propylsulfamoyl)phenyl]urea |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=O)NCC2(O)CCCNC2)cc1 |
| InChI | InChI=1S/C16H26N4O4S/c1-2-9-19-25(23,24)14-6-4-13(5-7-14)20-15(21)18-12-16(22)8-3-10-17-11-16/h4-7,17,19,22H,2-3,8-12H2,1H3,(H2,18,20,21) |
| InChIKey | YMJVQDLASPXEAD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |