C14H19F2N3O3 — CID 118772340
3-[4-[1-(difluoromethyl)-5-methylpyrrole-2-carbonyl]piperazin-1-yl]propanoic acid (PubChem CID 118772340) has the molecular formula C14H19F2N3O3 and a molecular weight of 315.32 g/mol. Its IUPAC name is 3-[4-[1-(difluoromethyl)-5-methylpyrrole-2-carbonyl]piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-[1-(difluoromethyl)-5-methylpyrrole-2-carbonyl]piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 118772340 |
| Molecular Formula | C14H19F2N3O3 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-[4-[1-(difluoromethyl)-5-methylpyrrole-2-carbonyl]piperazin-1-yl]propanoic acid |
| SMILES | Cc1ccc(C(=O)N2CCN(CCC(=O)O)CC2)n1C(F)F |
| InChI | InChI=1S/C14H19F2N3O3/c1-10-2-3-11(19(10)14(15)16)13(22)18-8-6-17(7-9-18)5-4-12(20)21/h2-3,14H,4-9H2,1H3,(H,20,21) |
| InChIKey | FLSOYELEGXLWCA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |