C19H22N2O2S — CID 118772808
5-acetyl-N-[1-(3-methylphenyl)piperidin-4-yl]thiophene-3-carboxamide (PubChem CID 118772808) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 5-acetyl-N-[1-(3-methylphenyl)piperidin-4-yl]thiophene-3-carboxamide.
| Compound Name | 5-acetyl-N-[1-(3-methylphenyl)piperidin-4-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 118772808 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 5-acetyl-N-[1-(3-methylphenyl)piperidin-4-yl]thiophene-3-carboxamide |
| SMILES | CC(=O)c1cc(C(=O)NC2CCN(c3cccc(C)c3)CC2)cs1 |
| InChI | InChI=1S/C19H22N2O2S/c1-13-4-3-5-17(10-13)21-8-6-16(7-9-21)20-19(23)15-11-18(14(2)22)24-12-15/h3-5,10-12,16H,6-9H2,1-2H3,(H,20,23) |
| InChIKey | KRKSIJKBNGNXAE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |