C18H26N4O2 — CID 118788710
(2S)-2-N-[1-(3-methylphenyl)piperidin-4-yl]pyrrolidine-1,2-dicarboxamide (PubChem CID 118788710) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (2S)-2-N-[1-(3-methylphenyl)piperidin-4-yl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-2-N-[1-(3-methylphenyl)piperidin-4-yl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 118788710 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (2S)-2-N-[1-(3-methylphenyl)piperidin-4-yl]pyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1cccc(N2CCC(NC(=O)[C@@H]3CCCN3C(N)=O)CC2)c1 |
| InChI | InChI=1S/C18H26N4O2/c1-13-4-2-5-15(12-13)21-10-7-14(8-11-21)20-17(23)16-6-3-9-22(16)18(19)24/h2,4-5,12,14,16H,3,6-11H2,1H3,(H2,19,24)(H,20,23)/t16-/m0/s1 |
| InChIKey | NFNKSMZPDNJMPB-INIZCTEOSA-N |
| XLogP | 1.62 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |