C19H28N4O4 — CID 171689581
formic acid;(2S)-2-N-[1-(3-methylphenyl)piperidin-4-yl]pyrrolidine-1,2-dicarboxamide (PubChem CID 171689581) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is formic acid;(2S)-2-N-[1-(3-methylphenyl)piperidin-4-yl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | formic acid;(2S)-2-N-[1-(3-methylphenyl)piperidin-4-yl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 171689581 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | formic acid;(2S)-2-N-[1-(3-methylphenyl)piperidin-4-yl]pyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1cccc(N2CCC(NC(=O)[C@@H]3CCCN3C(N)=O)CC2)c1.O=CO |
| InChI | InChI=1S/C18H26N4O2.CH2O2/c1-13-4-2-5-15(12-13)21-10-7-14(8-11-21)20-17(23)16-6-3-9-22(16)18(19)24;2-1-3/h2,4-5,12,14,16H,3,6-11H2,1H3,(H2,19,24)(H,20,23);1H,(H,2,3)/t16-;/m0./s1 |
| InChIKey | PAENKFIQRQLAFM-NTISSMGPSA-N |
| XLogP | 1.32 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|