C14H17FN4O3 — CID 118773023
2-(3-aminopropoxy)-5-fluoro-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]benzamide (PubChem CID 118773023) has the molecular formula C14H17FN4O3 and a molecular weight of 308.31 g/mol. Its IUPAC name is 2-(3-aminopropoxy)-5-fluoro-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]benzamide.
| Compound Name | 2-(3-aminopropoxy)-5-fluoro-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 118773023 |
| Molecular Formula | C14H17FN4O3 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-(3-aminopropoxy)-5-fluoro-N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]benzamide |
| SMILES | Cc1nonc1CNC(=O)c1cc(F)ccc1OCCCN |
| InChI | InChI=1S/C14H17FN4O3/c1-9-12(19-22-18-9)8-17-14(20)11-7-10(15)3-4-13(11)21-6-2-5-16/h3-4,7H,2,5-6,8,16H2,1H3,(H,17,20) |
| InChIKey | KCZBNHAFYGYUGD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|