C14H20ClFN2O3 — CID 166174931
2-(2-aminoethoxy)-5-fluoro-N-(oxan-4-yl)benzamide;hydrochloride (PubChem CID 166174931) has the molecular formula C14H20ClFN2O3 and a molecular weight of 318.78 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-5-fluoro-N-(oxan-4-yl)benzamide;hydrochloride.
| Compound Name | 2-(2-aminoethoxy)-5-fluoro-N-(oxan-4-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 166174931 |
| Molecular Formula | C14H20ClFN2O3 |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-(2-aminoethoxy)-5-fluoro-N-(oxan-4-yl)benzamide;hydrochloride |
| SMILES | Cl.NCCOc1ccc(F)cc1C(=O)NC1CCOCC1 |
| InChI | InChI=1S/C14H19FN2O3.ClH/c15-10-1-2-13(20-8-5-16)12(9-10)14(18)17-11-3-6-19-7-4-11;/h1-2,9,11H,3-8,16H2,(H,17,18);1H |
| InChIKey | FFEXGJGCCMFLIA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |