C16H20N4O2 — CID 118773668
6-cyano-N-[[4-(methylcarbamoyl)cyclohexyl]methyl]pyridine-3-carboxamide (PubChem CID 118773668) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 6-cyano-N-[[4-(methylcarbamoyl)cyclohexyl]methyl]pyridine-3-carboxamide.
| Compound Name | 6-cyano-N-[[4-(methylcarbamoyl)cyclohexyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118773668 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 6-cyano-N-[[4-(methylcarbamoyl)cyclohexyl]methyl]pyridine-3-carboxamide |
| SMILES | CNC(=O)C1CCC(CNC(=O)c2ccc(C#N)nc2)CC1 |
| InChI | InChI=1S/C16H20N4O2/c1-18-15(21)12-4-2-11(3-5-12)9-20-16(22)13-6-7-14(8-17)19-10-13/h6-7,10-12H,2-5,9H2,1H3,(H,18,21)(H,20,22) |
| InChIKey | WACLDKDTMFOQIM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |