C16H15N3O — CID 67567287
6-cyano-N-[(4-ethylphenyl)methyl]pyridine-3-carboxamide (PubChem CID 67567287) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 6-cyano-N-[(4-ethylphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-cyano-N-[(4-ethylphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67567287 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 6-cyano-N-[(4-ethylphenyl)methyl]pyridine-3-carboxamide |
| SMILES | CCc1ccc(CNC(=O)c2ccc(C#N)nc2)cc1 |
| InChI | InChI=1S/C16H15N3O/c1-2-12-3-5-13(6-4-12)10-19-16(20)14-7-8-15(9-17)18-11-14/h3-8,11H,2,10H2,1H3,(H,19,20) |
| InChIKey | WGZSUSJWTNNRFD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |