C20H22FNO2S — CID 118774076
[3-(3-fluoro-2-hydroxyphenyl)phenyl]-[4-(methylsulfanylmethyl)piperidin-1-yl]methanone (PubChem CID 118774076) has the molecular formula C20H22FNO2S and a molecular weight of 359.47 g/mol. Its IUPAC name is [3-(3-fluoro-2-hydroxyphenyl)phenyl]-[4-(methylsulfanylmethyl)piperidin-1-yl]methanone.
| Compound Name | [3-(3-fluoro-2-hydroxyphenyl)phenyl]-[4-(methylsulfanylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118774076 |
| Molecular Formula | C20H22FNO2S |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | [3-(3-fluoro-2-hydroxyphenyl)phenyl]-[4-(methylsulfanylmethyl)piperidin-1-yl]methanone |
| SMILES | CSCC1CCN(C(=O)c2cccc(-c3cccc(F)c3O)c2)CC1 |
| InChI | InChI=1S/C20H22FNO2S/c1-25-13-14-8-10-22(11-9-14)20(24)16-5-2-4-15(12-16)17-6-3-7-18(21)19(17)23/h2-7,12,14,23H,8-11,13H2,1H3 |
| InChIKey | PAWHSUNRQCMPPZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |