C17H18FN3O — CID 118775431
2-(3-fluorophenyl)-1-(4-pyrimidin-4-ylpiperidin-1-yl)ethanone (PubChem CID 118775431) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-(4-pyrimidin-4-ylpiperidin-1-yl)ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-(4-pyrimidin-4-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 118775431 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-(3-fluorophenyl)-1-(4-pyrimidin-4-ylpiperidin-1-yl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1)N1CCC(c2ccncn2)CC1 |
| InChI | InChI=1S/C17H18FN3O/c18-15-3-1-2-13(10-15)11-17(22)21-8-5-14(6-9-21)16-4-7-19-12-20-16/h1-4,7,10,12,14H,5-6,8-9,11H2 |
| InChIKey | SIZXMYGRNKJIIU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |