C16H24N2O4 — CID 118776796
2-[4-(2-methoxyethoxy)piperidine-1-carbonyl]-1,6-dimethylpyridin-4-one (PubChem CID 118776796) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[4-(2-methoxyethoxy)piperidine-1-carbonyl]-1,6-dimethylpyridin-4-one.
| Compound Name | 2-[4-(2-methoxyethoxy)piperidine-1-carbonyl]-1,6-dimethylpyridin-4-one |
|---|---|
| PubChem CID | 118776796 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-[4-(2-methoxyethoxy)piperidine-1-carbonyl]-1,6-dimethylpyridin-4-one |
| SMILES | COCCOC1CCN(C(=O)c2cc(=O)cc(C)n2C)CC1 |
| InChI | InChI=1S/C16H24N2O4/c1-12-10-13(19)11-15(17(12)2)16(20)18-6-4-14(5-7-18)22-9-8-21-3/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | STJOBVDXTTXRJL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|