C18H23FN4OS — CID 118779314
3-[1-[(3-fluorophenyl)methyl]-4-methylpyrazol-5-yl]-1-methyl-1-(thian-4-yl)urea (PubChem CID 118779314) has the molecular formula C18H23FN4OS and a molecular weight of 362.47 g/mol. Its IUPAC name is 3-[1-[(3-fluorophenyl)methyl]-4-methylpyrazol-5-yl]-1-methyl-1-(thian-4-yl)urea.
| Compound Name | 3-[1-[(3-fluorophenyl)methyl]-4-methylpyrazol-5-yl]-1-methyl-1-(thian-4-yl)urea |
|---|---|
| PubChem CID | 118779314 |
| Molecular Formula | C18H23FN4OS |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-[1-[(3-fluorophenyl)methyl]-4-methylpyrazol-5-yl]-1-methyl-1-(thian-4-yl)urea |
| SMILES | Cc1cnn(Cc2cccc(F)c2)c1NC(=O)N(C)C1CCSCC1 |
| InChI | InChI=1S/C18H23FN4OS/c1-13-11-20-23(12-14-4-3-5-15(19)10-14)17(13)21-18(24)22(2)16-6-8-25-9-7-16/h3-5,10-11,16H,6-9,12H2,1-2H3,(H,21,24) |
| InChIKey | UZTFEFFRNHXJJZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |