C22H26N2O2 — CID 118779442
4-[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]-1-phenylpyrrolidin-2-one (PubChem CID 118779442) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]-1-phenylpyrrolidin-2-one.
| Compound Name | 4-[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]-1-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 118779442 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-[(4-hydroxy-4-phenylpiperidin-1-yl)methyl]-1-phenylpyrrolidin-2-one |
| SMILES | O=C1CC(CN2CCC(O)(c3ccccc3)CC2)CN1c1ccccc1 |
| InChI | InChI=1S/C22H26N2O2/c25-21-15-18(17-24(21)20-9-5-2-6-10-20)16-23-13-11-22(26,12-14-23)19-7-3-1-4-8-19/h1-10,18,26H,11-17H2 |
| InChIKey | HMMLMTPWJJWGOZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |