C19H28N4O3S — CID 125173786
(4R)-1-phenyl-4-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]pyrrolidin-2-one (PubChem CID 125173786) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is (4R)-1-phenyl-4-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]pyrrolidin-2-one.
| Compound Name | (4R)-1-phenyl-4-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 125173786 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (4R)-1-phenyl-4-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]pyrrolidin-2-one |
| SMILES | O=C1C[C@H](CN2CCN(S(=O)(=O)N3CCCC3)CC2)CN1c1ccccc1 |
| InChI | InChI=1S/C19H28N4O3S/c24-19-14-17(16-23(19)18-6-2-1-3-7-18)15-20-10-12-22(13-11-20)27(25,26)21-8-4-5-9-21/h1-3,6-7,17H,4-5,8-16H2/t17-/m1/s1 |
| InChIKey | CGQTVUFXTLJTGY-QGZVFWFLSA-N |
| XLogP | 1.00 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |