C16H23N3O3S — CID 16919583
N-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]piperidine-1-sulfonamide (PubChem CID 16919583) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is N-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]piperidine-1-sulfonamide.
| Compound Name | N-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 16919583 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]piperidine-1-sulfonamide |
| SMILES | O=C1CC(CNS(=O)(=O)N2CCCCC2)CN1c1ccccc1 |
| InChI | InChI=1S/C16H23N3O3S/c20-16-11-14(13-19(16)15-7-3-1-4-8-15)12-17-23(21,22)18-9-5-2-6-10-18/h1,3-4,7-8,14,17H,2,5-6,9-13H2 |
| InChIKey | ISEPODCEICVREJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |