C14H16N4O3S — CID 131935929
N-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]-1H-pyrazole-4-sulfonamide (PubChem CID 131935929) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is N-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 131935929 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-[(5-oxo-1-phenylpyrrolidin-3-yl)methyl]-1H-pyrazole-4-sulfonamide |
| SMILES | O=C1CC(CNS(=O)(=O)c2cn[nH]c2)CN1c1ccccc1 |
| InChI | InChI=1S/C14H16N4O3S/c19-14-6-11(10-18(14)12-4-2-1-3-5-12)7-17-22(20,21)13-8-15-16-9-13/h1-5,8-9,11,17H,6-7,10H2,(H,15,16) |
| InChIKey | PXRRWKCZWHJCBH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |