C10H13ClOS — CID 11877957
(2S,4R,4aS,8aS)-6-chloro-2-methyl-3,4,4a,8a-tetrahydro-2H-thiochromen-4-ol (PubChem CID 11877957) has the molecular formula C10H13ClOS and a molecular weight of 216.73 g/mol. Its IUPAC name is (2S,4R,4aS,8aS)-6-chloro-2-methyl-3,4,4a,8a-tetrahydro-2H-thiochromen-4-ol.
| Compound Name | (2S,4R,4aS,8aS)-6-chloro-2-methyl-3,4,4a,8a-tetrahydro-2H-thiochromen-4-ol |
|---|---|
| PubChem CID | 11877957 |
| Molecular Formula | C10H13ClOS |
| Molecular Weight | 216.73 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | (2S,4R,4aS,8aS)-6-chloro-2-methyl-3,4,4a,8a-tetrahydro-2H-thiochromen-4-ol |
| SMILES | C[C@H]1C[C@@H](O)[C@@H]2C=C(Cl)C=C[C@@H]2S1 |
| InChI | InChI=1S/C10H13ClOS/c1-6-4-9(12)8-5-7(11)2-3-10(8)13-6/h2-3,5-6,8-10,12H,4H2,1H3/t6-,8-,9+,10-/m0/s1 |
| InChIKey | CDLMBTLYJNUUMV-MCNGFCJOSA-N |
| XLogP | 2.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |