C18H23ClN2O2 — CID 118783454
[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[2-(2-aminoethoxy)-5-chlorophenyl]methanone (PubChem CID 118783454) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[2-(2-aminoethoxy)-5-chlorophenyl]methanone.
| Compound Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[2-(2-aminoethoxy)-5-chlorophenyl]methanone |
|---|---|
| PubChem CID | 118783454 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[2-(2-aminoethoxy)-5-chlorophenyl]methanone |
| SMILES | CC1=CC[C@@H]2CN(C(=O)c3cc(Cl)ccc3OCCN)C[C@@H]2C1 |
| InChI | InChI=1S/C18H23ClN2O2/c1-12-2-3-13-10-21(11-14(13)8-12)18(22)16-9-15(19)4-5-17(16)23-7-6-20/h2,4-5,9,13-14H,3,6-8,10-11,20H2,1H3/t13-,14+/m1/s1 |
| InChIKey | IIWQZLXYRJTTHE-KGLIPLIRSA-N |
| XLogP | 3.11 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|