C20H21N3O4 — CID 118784987
2-(5-methyl-1,2-oxazol-3-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-1-carboxamide (PubChem CID 118784987) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-(5-methyl-1,2-oxazol-3-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-1-carboxamide.
| Compound Name | 2-(5-methyl-1,2-oxazol-3-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 118784987 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-(5-methyl-1,2-oxazol-3-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-1-carboxamide |
| SMILES | Cc1cc(C2CCCCN2C(=O)Nc2ccc3c(C)cc(=O)oc3c2)no1 |
| InChI | InChI=1S/C20H21N3O4/c1-12-9-19(24)26-18-11-14(6-7-15(12)18)21-20(25)23-8-4-3-5-17(23)16-10-13(2)27-22-16/h6-7,9-11,17H,3-5,8H2,1-2H3,(H,21,25) |
| InChIKey | DICRQDSTUFOJBL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|