C19H20N4O4 — CID 97270391
(2R)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-1-carboxamide (PubChem CID 97270391) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is (2R)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-1-carboxamide.
| Compound Name | (2R)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97270391 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (2R)-2-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-1-carboxamide |
| SMILES | Cc1noc([C@H]2CCCCN2C(=O)Nc2ccc3c(C)cc(=O)oc3c2)n1 |
| InChI | InChI=1S/C19H20N4O4/c1-11-9-17(24)26-16-10-13(6-7-14(11)16)21-19(25)23-8-4-3-5-15(23)18-20-12(2)22-27-18/h6-7,9-10,15H,3-5,8H2,1-2H3,(H,21,25)/t15-/m1/s1 |
| InChIKey | WHSOJEGXBXJAGX-OAHLLOKOSA-N |
| XLogP | 3.55 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|