C19H24N4O2 — CID 118786649
N-[1-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]-4-oxo-4-phenylbutanamide (PubChem CID 118786649) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[1-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]-4-oxo-4-phenylbutanamide.
| Compound Name | N-[1-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 118786649 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-[1-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]-4-oxo-4-phenylbutanamide |
| SMILES | CC(NC(=O)CCC(=O)c1ccccc1)c1nncn1C1CCCC1 |
| InChI | InChI=1S/C19H24N4O2/c1-14(19-22-20-13-23(19)16-9-5-6-10-16)21-18(25)12-11-17(24)15-7-3-2-4-8-15/h2-4,7-8,13-14,16H,5-6,9-12H2,1H3,(H,21,25) |
| InChIKey | BLQHTXONBLPCKP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |