C21H23N5O — CID 68512967
N-[1-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]-4-pyridin-4-ylbenzamide (PubChem CID 68512967) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is N-[1-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]-4-pyridin-4-ylbenzamide.
| Compound Name | N-[1-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]-4-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 68512967 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | N-[1-(4-cyclopentyl-1,2,4-triazol-3-yl)ethyl]-4-pyridin-4-ylbenzamide |
| SMILES | CC(NC(=O)c1ccc(-c2ccncc2)cc1)c1nncn1C1CCCC1 |
| InChI | InChI=1S/C21H23N5O/c1-15(20-25-23-14-26(20)19-4-2-3-5-19)24-21(27)18-8-6-16(7-9-18)17-10-12-22-13-11-17/h6-15,19H,2-5H2,1H3,(H,24,27) |
| InChIKey | BTAQORYRBPTSNM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |