C8H12O3S — CID 11878670
(1R,2R,5R)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]non-6-en-2-ol (PubChem CID 11878670) has the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. Its IUPAC name is (1R,2R,5R)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]non-6-en-2-ol.
| Compound Name | (1R,2R,5R)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]non-6-en-2-ol |
|---|---|
| PubChem CID | 11878670 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (1R,2R,5R)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]non-6-en-2-ol |
| SMILES | O=S1(=O)[C@@H]2CC=C[C@H]1CC[C@H]2O |
| InChI | InChI=1S/C8H12O3S/c9-7-5-4-6-2-1-3-8(7)12(6,10)11/h1-2,6-9H,3-5H2/t6-,7+,8+/m0/s1 |
| InChIKey | QIVNWKYDTXGSAN-XLPZGREQSA-N |
| XLogP | 0.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|