C8H12OS — CID 1201024
(1R,2S,5R)-9-thiabicyclo[3.3.1]non-6-en-2-ol (PubChem CID 1201024) has the molecular formula C8H12OS and a molecular weight of 156.25 g/mol. Its IUPAC name is (1R,2S,5R)-9-thiabicyclo[3.3.1]non-6-en-2-ol.
| Compound Name | (1R,2S,5R)-9-thiabicyclo[3.3.1]non-6-en-2-ol |
|---|---|
| PubChem CID | 1201024 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (1R,2S,5R)-9-thiabicyclo[3.3.1]non-6-en-2-ol |
| SMILES | O[C@H]1CC[C@@H]2C=CC[C@H]1S2 |
| InChI | InChI=1S/C8H12OS/c9-7-5-4-6-2-1-3-8(7)10-6/h1-2,6-9H,3-5H2/t6-,7-,8+/m0/s1 |
| InChIKey | AOOFJUDSYUDQMT-BIIVOSGPSA-N |
| XLogP | 1.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|