C19H25N3O3S — CID 118787365
3-[2-(2-methoxyethoxy)phenyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)urea (PubChem CID 118787365) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)phenyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)urea.
| Compound Name | 3-[2-(2-methoxyethoxy)phenyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 118787365 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)phenyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)urea |
| SMILES | COCCOc1ccccc1NC(=O)N(C)Cc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C19H25N3O3S/c1-22(13-18-20-15-8-4-6-10-17(15)26-18)19(23)21-14-7-3-5-9-16(14)25-12-11-24-2/h3,5,7,9H,4,6,8,10-13H2,1-2H3,(H,21,23) |
| InChIKey | DXAFTDUPOFABNP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|