C21H29N5O2S — CID 111991867
N-[2-[[ethylamino-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]methylidene]amino]ethyl]-2-hydroxybenzamide (PubChem CID 111991867) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[2-[[ethylamino-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]methylidene]amino]ethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[[ethylamino-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]methylidene]amino]ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 111991867 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[2-[[ethylamino-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]methylidene]amino]ethyl]-2-hydroxybenzamide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccccc1O)N(C)Cc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C21H29N5O2S/c1-3-22-21(24-13-12-23-20(28)15-8-4-6-10-17(15)27)26(2)14-19-25-16-9-5-7-11-18(16)29-19/h4,6,8,10,27H,3,5,7,9,11-14H2,1-2H3,(H,22,24)(H,23,28) |
| InChIKey | PGWUOPTTYMHGJD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|