C21H32N4O2S — CID 110054040
2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine (PubChem CID 110054040) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is 2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine.
| Compound Name | 2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110054040 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-1-methyl-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)guanidine |
| SMILES | CCOCCC/N=C(\NCCc1ccco1)N(C)Cc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C21H32N4O2S/c1-3-26-14-7-12-22-21(23-13-11-17-8-6-15-27-17)25(2)16-20-24-18-9-4-5-10-19(18)28-20/h6,8,15H,3-5,7,9-14,16H2,1-2H3,(H,22,23) |
| InChIKey | GBICCJMKTCQMDO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|