C20H23NO5 — CID 118787801
2-[3-[(4-methoxyphenoxy)methyl]piperidine-1-carbonyl]-6-methylpyran-4-one (PubChem CID 118787801) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-[3-[(4-methoxyphenoxy)methyl]piperidine-1-carbonyl]-6-methylpyran-4-one.
| Compound Name | 2-[3-[(4-methoxyphenoxy)methyl]piperidine-1-carbonyl]-6-methylpyran-4-one |
|---|---|
| PubChem CID | 118787801 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-[3-[(4-methoxyphenoxy)methyl]piperidine-1-carbonyl]-6-methylpyran-4-one |
| SMILES | COc1ccc(OCC2CCCN(C(=O)c3cc(=O)cc(C)o3)C2)cc1 |
| InChI | InChI=1S/C20H23NO5/c1-14-10-16(22)11-19(26-14)20(23)21-9-3-4-15(12-21)13-25-18-7-5-17(24-2)6-8-18/h5-8,10-11,15H,3-4,9,12-13H2,1-2H3 |
| InChIKey | DKOVHYBTXAQYOE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |