C22H30N4O3 — CID 42190508
(1-cyclohexyltriazol-4-yl)-[(3R)-3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]methanone (PubChem CID 42190508) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is (1-cyclohexyltriazol-4-yl)-[(3R)-3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]methanone.
| Compound Name | (1-cyclohexyltriazol-4-yl)-[(3R)-3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42190508 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (1-cyclohexyltriazol-4-yl)-[(3R)-3-[(4-methoxyphenoxy)methyl]piperidin-1-yl]methanone |
| SMILES | COc1ccc(OC[C@@H]2CCCN(C(=O)c3cn(C4CCCCC4)nn3)C2)cc1 |
| InChI | InChI=1S/C22H30N4O3/c1-28-19-9-11-20(12-10-19)29-16-17-6-5-13-25(14-17)22(27)21-15-26(24-23-21)18-7-3-2-4-8-18/h9-12,15,17-18H,2-8,13-14,16H2,1H3/t17-/m1/s1 |
| InChIKey | DLMPSLCDTNCHEB-QGZVFWFLSA-N |
| XLogP | 3.72 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |