C23H29N5O3 — CID 74441833
3-(4-methoxyphenyl)-1-[4-[4-(piperidine-1-carbonyl)triazol-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 74441833) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-[4-[4-(piperidine-1-carbonyl)triazol-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(4-methoxyphenyl)-1-[4-[4-(piperidine-1-carbonyl)triazol-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 74441833 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-[4-[4-(piperidine-1-carbonyl)triazol-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)N2CCC(n3cc(C(=O)N4CCCCC4)nn3)CC2)cc1 |
| InChI | InChI=1S/C23H29N5O3/c1-31-20-8-5-18(6-9-20)7-10-22(29)26-15-11-19(12-16-26)28-17-21(24-25-28)23(30)27-13-3-2-4-14-27/h5-10,17,19H,2-4,11-16H2,1H3 |
| InChIKey | ZNSRNWHHCBOKNQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|