C18H20ClN3O — CID 118788271
2-[[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-7-chloropyrido[1,2-a]pyrimidin-4-one (PubChem CID 118788271) has the molecular formula C18H20ClN3O and a molecular weight of 329.83 g/mol. Its IUPAC name is 2-[[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-7-chloropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-7-chloropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 118788271 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-[[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]methyl]-7-chloropyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC1=CC[C@@H]2CN(Cc3cc(=O)n4cc(Cl)ccc4n3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H20ClN3O/c1-12-2-3-13-8-21(9-14(13)6-12)11-16-7-18(23)22-10-15(19)4-5-17(22)20-16/h2,4-5,7,10,13-14H,3,6,8-9,11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | DGKNGCUVFOHFEM-KGLIPLIRSA-N |
| XLogP | 3.14 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|