C17H28N4O2 — CID 118788925
(5-ethyl-1H-pyrazol-4-yl)-[4-(1-morpholin-4-ylethyl)piperidin-1-yl]methanone (PubChem CID 118788925) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is (5-ethyl-1H-pyrazol-4-yl)-[4-(1-morpholin-4-ylethyl)piperidin-1-yl]methanone.
| Compound Name | (5-ethyl-1H-pyrazol-4-yl)-[4-(1-morpholin-4-ylethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118788925 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (5-ethyl-1H-pyrazol-4-yl)-[4-(1-morpholin-4-ylethyl)piperidin-1-yl]methanone |
| SMILES | CCc1[nH]ncc1C(=O)N1CCC(C(C)N2CCOCC2)CC1 |
| InChI | InChI=1S/C17H28N4O2/c1-3-16-15(12-18-19-16)17(22)21-6-4-14(5-7-21)13(2)20-8-10-23-11-9-20/h12-14H,3-11H2,1-2H3,(H,18,19) |
| InChIKey | CKVJKIQDTYQAKH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |