C20H28N4O2 — CID 99938258
2-indazol-1-yl-1-[4-[(1R)-1-morpholin-4-ylethyl]piperidin-1-yl]ethanone (PubChem CID 99938258) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-indazol-1-yl-1-[4-[(1R)-1-morpholin-4-ylethyl]piperidin-1-yl]ethanone.
| Compound Name | 2-indazol-1-yl-1-[4-[(1R)-1-morpholin-4-ylethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 99938258 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-indazol-1-yl-1-[4-[(1R)-1-morpholin-4-ylethyl]piperidin-1-yl]ethanone |
| SMILES | C[C@H](C1CCN(C(=O)Cn2ncc3ccccc32)CC1)N1CCOCC1 |
| InChI | InChI=1S/C20H28N4O2/c1-16(22-10-12-26-13-11-22)17-6-8-23(9-7-17)20(25)15-24-19-5-3-2-4-18(19)14-21-24/h2-5,14,16-17H,6-13,15H2,1H3/t16-/m1/s1 |
| InChIKey | ITGZHZHJKQQLJD-MRXNPFEDSA-N |
| XLogP | 2.00 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |