C16H25N3O3 — CID 118791173
3-amino-N-[2-(2-ethoxyethoxy)phenyl]piperidine-1-carboxamide (PubChem CID 118791173) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-amino-N-[2-(2-ethoxyethoxy)phenyl]piperidine-1-carboxamide.
| Compound Name | 3-amino-N-[2-(2-ethoxyethoxy)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 118791173 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 3-amino-N-[2-(2-ethoxyethoxy)phenyl]piperidine-1-carboxamide |
| SMILES | CCOCCOc1ccccc1NC(=O)N1CCCC(N)C1 |
| InChI | InChI=1S/C16H25N3O3/c1-2-21-10-11-22-15-8-4-3-7-14(15)18-16(20)19-9-5-6-13(17)12-19/h3-4,7-8,13H,2,5-6,9-12,17H2,1H3,(H,18,20) |
| InChIKey | NHJNPTHOHZRAKI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|