C21H26N2O4 — CID 125168132
(2R)-N-[2-(2-ethoxyethoxy)phenyl]-2-(3-methoxyphenyl)azetidine-1-carboxamide (PubChem CID 125168132) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (2R)-N-[2-(2-ethoxyethoxy)phenyl]-2-(3-methoxyphenyl)azetidine-1-carboxamide.
| Compound Name | (2R)-N-[2-(2-ethoxyethoxy)phenyl]-2-(3-methoxyphenyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 125168132 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (2R)-N-[2-(2-ethoxyethoxy)phenyl]-2-(3-methoxyphenyl)azetidine-1-carboxamide |
| SMILES | CCOCCOc1ccccc1NC(=O)N1CC[C@@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-3-26-13-14-27-20-10-5-4-9-18(20)22-21(24)23-12-11-19(23)16-7-6-8-17(15-16)25-2/h4-10,15,19H,3,11-14H2,1-2H3,(H,22,24)/t19-/m1/s1 |
| InChIKey | SLKPXDPIWFIDMV-LJQANCHMSA-N |
| XLogP | 4.09 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|