C18H25N3O2 — CID 118794851
4-(azepane-4-carbonyl)-1-benzylpiperazin-2-one (PubChem CID 118794851) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-(azepane-4-carbonyl)-1-benzylpiperazin-2-one.
| Compound Name | 4-(azepane-4-carbonyl)-1-benzylpiperazin-2-one |
|---|---|
| PubChem CID | 118794851 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 4-(azepane-4-carbonyl)-1-benzylpiperazin-2-one |
| SMILES | O=C1CN(C(=O)C2CCCNCC2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C18H25N3O2/c22-17-14-21(18(23)16-7-4-9-19-10-8-16)12-11-20(17)13-15-5-2-1-3-6-15/h1-3,5-6,16,19H,4,7-14H2 |
| InChIKey | JCUHCMSZNVIBIX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |