C16H20ClN3O2 — CID 119330488
1-[(4-chlorophenyl)methyl]-4-(pyrrolidine-2-carbonyl)piperazin-2-one (PubChem CID 119330488) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-4-(pyrrolidine-2-carbonyl)piperazin-2-one.
| Compound Name | 1-[(4-chlorophenyl)methyl]-4-(pyrrolidine-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 119330488 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-4-(pyrrolidine-2-carbonyl)piperazin-2-one |
| SMILES | O=C1CN(C(=O)C2CCCN2)CCN1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN3O2/c17-13-5-3-12(4-6-13)10-19-8-9-20(11-15(19)21)16(22)14-2-1-7-18-14/h3-6,14,18H,1-2,7-11H2 |
| InChIKey | DLEXUTGUMRUPLN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |