About 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one
8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one (PubChem CID 118797188) has the molecular formula C9H9N5O2
and a molecular weight of 219.20 g/mol. Its IUPAC name is 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one.
Molecular Properties
| Compound Name | 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one |
| PubChem CID | 118797188 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one |
| SMILES | CC1CC(O)n2c(nc3c(c2=O)=NC=N3)=N1 |
| InChI | InChI=1S/C9H9N5O2/c1-4-2-5(15)14-8(16)6-7(11-3-10-6)13-9(14)12-4/h3-5,15H,2H2,1H3 |
| InChIKey | WFWAFZMQOCVSTH-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one?
The IUPAC name of 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one (CID 118797188) is 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one.
What is the SMILES notation for 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one?
The canonical SMILES for 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one is CC1CC(O)n2c(nc3c(c2=O)=NC=N3)=N1.
What is the InChIKey of 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one?
The InChIKey is WFWAFZMQOCVSTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5O2/c1-4-2-5(15)14-8(16)6-7(11-3-10-6)13-9(14)12-4/h3-5,15H,2H2,1H3.
What are the key properties of 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one?
8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one has a molecular weight of 219.20 g/mol, XLogP of -1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-6-methyl-7,8-dihydro-6H-pyrimido[1,2-a]purin-10-one is sourced from PubChem (CID 118797188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).