C11H15N5O3 — CID 137288192
8-(4-hydroxybutan-2-ylimino)-1,3-dimethylpurine-2,6-dione (PubChem CID 137288192) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 8-(4-hydroxybutan-2-ylimino)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-(4-hydroxybutan-2-ylimino)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 137288192 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 8-(4-hydroxybutan-2-ylimino)-1,3-dimethylpurine-2,6-dione |
| SMILES | CC(CCO)/N=C1\N=c2c(=O)n(C)c(=O)n(C)c2=N1 |
| InChI | InChI=1S/C11H15N5O3/c1-6(4-5-17)12-10-13-7-8(14-10)15(2)11(19)16(3)9(7)18/h6,17H,4-5H2,1-3H3/b12-10+ |
| InChIKey | NTEBHSVGAHUKLV-ZRDIBKRKSA-N |
| XLogP | -2.54 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|