C10H15N4O3+ — CID 75609046
9-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-9-ium-2,6-dione (PubChem CID 75609046) has the molecular formula C10H15N4O3+ and a molecular weight of 239.25 g/mol. Its IUPAC name is 9-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-9-ium-2,6-dione.
| Compound Name | 9-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-9-ium-2,6-dione |
|---|---|
| PubChem CID | 75609046 |
| Molecular Formula | C10H15N4O3+ |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 9-(3-hydroxypropyl)-1,3-dimethyl-5H-purin-9-ium-2,6-dione |
| SMILES | CN1C(=O)C2N=C[N+](CCCO)=C2N(C)C1=O |
| InChI | InChI=1S/C10H15N4O3/c1-12-8-7(9(16)13(2)10(12)17)11-6-14(8)4-3-5-15/h6-7,15H,3-5H2,1-2H3/q+1 |
| InChIKey | SQJJHQBUYJZKBN-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|