C8H14N4O2 — CID 163708592
2-hydroxy-1,3,7-trimethyl-4,5-dihydro-2H-purin-6-one (PubChem CID 163708592) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-hydroxy-1,3,7-trimethyl-4,5-dihydro-2H-purin-6-one.
| Compound Name | 2-hydroxy-1,3,7-trimethyl-4,5-dihydro-2H-purin-6-one |
|---|---|
| PubChem CID | 163708592 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-hydroxy-1,3,7-trimethyl-4,5-dihydro-2H-purin-6-one |
| SMILES | CN1C=NC2C1C(=O)N(C)C(O)N2C |
| InChI | InChI=1S/C8H14N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4-6,8,14H,1-3H3 |
| InChIKey | KHFOSANXRNWSQZ-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |