C9H11N5O2 — CID 167996775
8-ethylimino-1,3-dimethylpurine-2,6-dione (PubChem CID 167996775) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 8-ethylimino-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-ethylimino-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 167996775 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 8-ethylimino-1,3-dimethylpurine-2,6-dione |
| SMILES | CC/N=C1\N=c2c(=O)n(C)c(=O)n(C)c2=N1 |
| InChI | InChI=1S/C9H11N5O2/c1-4-10-8-11-5-6(12-8)13(2)9(16)14(3)7(5)15/h4H2,1-3H3/b10-8+ |
| InChIKey | UVJSBGZBVMZOKI-CSKARUKUSA-N |
| XLogP | -2.29 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|