C7H6N4O2S — CID 78205811
1,3-dimethyl-8-sulfanylidenepurine-2,6-dione (PubChem CID 78205811) has the molecular formula C7H6N4O2S and a molecular weight of 210.22 g/mol. Its IUPAC name is 1,3-dimethyl-8-sulfanylidenepurine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-sulfanylidenepurine-2,6-dione |
|---|---|
| PubChem CID | 78205811 |
| Molecular Formula | C7H6N4O2S |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 1,3-dimethyl-8-sulfanylidenepurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=NC(=S)N=2 |
| InChI | InChI=1S/C7H6N4O2S/c1-10-4-3(8-6(14)9-4)5(12)11(2)7(10)13/h1-2H3 |
| InChIKey | MNOLDEWETDDULX-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 68.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|