About 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid
1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid (PubChem CID 90469881) has the molecular formula C7H4N4O4S
and a molecular weight of 240.20 g/mol. Its IUPAC name is 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid |
| PubChem CID | 90469881 |
| Molecular Formula | C7H4N4O4S |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid |
| SMILES | Cn1c(=O)c2c(n(C(=O)O)c1=O)=NC(=S)N=2 |
| InChI | InChI=1S/C7H4N4O4S/c1-10-4(12)2-3(9-5(16)8-2)11(6(10)13)7(14)15/h1H3,(H,14,15) |
| InChIKey | PDASQFMLKQWVDJ-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid?
The IUPAC name of 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid (CID 90469881) is 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid.
What is the SMILES notation for 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid?
The canonical SMILES for 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid is Cn1c(=O)c2c(n(C(=O)O)c1=O)=NC(=S)N=2.
What is the InChIKey of 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid?
The InChIKey is PDASQFMLKQWVDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4O4S/c1-10-4(12)2-3(9-5(16)8-2)11(6(10)13)7(14)15/h1H3,(H,14,15).
What are the key properties of 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid?
1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid has a molecular weight of 240.20 g/mol, XLogP of -2.39, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,6-dioxo-8-sulfanylidenepurine-3-carboxylic acid is sourced from PubChem (CID 90469881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).