C9H11N5O3 — CID 156595417
8-(2-hydroxyethylimino)-1,3-dimethylpurine-2,6-dione (PubChem CID 156595417) has the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. Its IUPAC name is 8-(2-hydroxyethylimino)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-(2-hydroxyethylimino)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 156595417 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 8-(2-hydroxyethylimino)-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=N/C(=N/CCO)N=2 |
| InChI | InChI=1S/C9H11N5O3/c1-13-6-5(7(16)14(2)9(13)17)11-8(12-6)10-3-4-15/h15H,3-4H2,1-2H3/b10-8+ |
| InChIKey | YDQSSTLINDVBCN-CSKARUKUSA-N |
| XLogP | -3.31 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|