C9H13N4O3+ — CID 73160569
7-(2-hydroxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 73160569) has the molecular formula C9H13N4O3+ and a molecular weight of 225.23 g/mol. Its IUPAC name is 7-(2-hydroxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2-hydroxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73160569 |
| Molecular Formula | C9H13N4O3+ |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 7-(2-hydroxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CCO)N(C)C1=O |
| InChI | InChI=1S/C9H13N4O3/c1-11-7-6(8(15)12(2)9(11)16)13(3-4-14)5-10-7/h5-6,14H,3-4H2,1-2H3/q+1 |
| InChIKey | MZZLGKPPDZEQSK-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|