C9H12N4O3 — CID 138981866
1,3,9-trimethyl-2,6-dioxo-4,5-dihydropurine-8-carbaldehyde (PubChem CID 138981866) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 1,3,9-trimethyl-2,6-dioxo-4,5-dihydropurine-8-carbaldehyde.
| Compound Name | 1,3,9-trimethyl-2,6-dioxo-4,5-dihydropurine-8-carbaldehyde |
|---|---|
| PubChem CID | 138981866 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1,3,9-trimethyl-2,6-dioxo-4,5-dihydropurine-8-carbaldehyde |
| SMILES | CN1C(=O)C2N=C(C=O)N(C)C2N(C)C1=O |
| InChI | InChI=1S/C9H12N4O3/c1-11-5(4-14)10-6-7(11)12(2)9(16)13(3)8(6)15/h4,6-7H,1-3H3 |
| InChIKey | NPSXIFVUCJOQLO-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|